
CAS 104440-00-8
:2,3,4,9-Tetrahydro-1H-carbazol-8-amine
Description:
2,3,4,9-Tetrahydro-1H-carbazol-8-amine, with the CAS number 104440-00-8, is a chemical compound characterized by its bicyclic structure, which includes a carbazole moiety. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the nitrogen-containing ring system. It is an amine, which means it contains an amino group (-NH2) that can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The presence of the tetrahydro structure contributes to its potential as a building block in organic synthesis and medicinal chemistry. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Overall, 2,3,4,9-Tetrahydro-1H-carbazol-8-amine is a versatile compound with potential applications in various fields, including drug development and material science.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h3,5-6,14H,1-2,4,7,13H2
InChI key:InChIKey=XRVPYLJMIRUIJU-UHFFFAOYSA-N
SMILES:NC1=C2C(C3=C(N2)CCCC3)=CC=C1
Synonyms:- 1H-Carbazol-8-amine, 2,3,4,9-tetrahydro-
- 2,3,4,9-Tetrahydro-1H-carbazol-8-amine
- Carbazole, 8-amino-1,2,3,4-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.