
CAS 1044507-48-3
:4-(3-Oxetanyl)benzonitrile
Description:
4-(3-Oxetanyl)benzonitrile is an organic compound characterized by its unique structure, which includes a benzonitrile moiety and a 3-oxetanyl group. The presence of the nitrile functional group (-C≡N) indicates that it has potential applications in organic synthesis and pharmaceuticals due to its ability to participate in various chemical reactions, such as nucleophilic additions. The oxetane ring contributes to the compound's strain and reactivity, making it an interesting candidate for further chemical transformations. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential uses in materials science and medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for its identification and application in research and industry. As with any chemical substance, safety data and handling precautions should be considered when working with 4-(3-Oxetanyl)benzonitrile.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c11-5-8-1-3-9(4-2-8)10-6-12-7-10/h1-4,10H,6-7H2
InChI key:InChIKey=XXVYRUPKYONESN-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=C(C=C1)C2COC2
Synonyms:- Benzonitrile, 4-(3-oxetanyl)-
- 4-(3-Oxetanyl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.