CAS 104454-73-1

2-Oxazolidinone, 4-(2-methylpropyl)-5-phenyl-, (4S-cis)-

Description:

2-Oxazolidinone, 4-(2-methylpropyl)-5-phenyl-, (4S-cis)- is a chemical compound characterized by its oxazolidinone ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This specific compound features a chiral center, indicated by the (4S-cis) designation, which implies that it has a specific spatial arrangement of its substituents. The presence of a 2-methylpropyl group and a phenyl group contributes to its unique properties, potentially influencing its solubility, reactivity, and biological activity. Oxazolidinones are known for their applications in medicinal chemistry, particularly as antibacterial agents. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, although specific biological activities would require empirical investigation. Additionally, the compound's stability, melting point, and other physical properties would depend on its molecular interactions and the environment in which it is studied. Overall, 2-Oxazolidinone, 4-(2-methylpropyl)-5-phenyl-, (4S-cis)- represents a class of compounds with significant potential in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1S/C13H17NO2/c1-9(2)8-11-12(16-13(15)14-11)10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,14,15)/t11-,12+/m0/s1

InChI key: InChIKey=YYHKDAYVJJZHEN-NWDGAFQWSA-N

SMILES: C(C(C)C)[C@H]1[C@H](OC(=O)N1)C2=CC=CC=C2

Synonyms:

• 2-Oxazolidinone, 4-(2-methylpropyl)-5-phenyl-, (4S-cis)-