CymitQuimica logo

CAS 104459-73-6

:

N-Cyclopentylethenesulfonamide

Description:
N-Cyclopentylethenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its applications in medicinal chemistry and as a building block in organic synthesis. The compound features a cyclopentyl group attached to an ethenesulfonamide moiety, contributing to its unique chemical properties. Typically, sulfonamides exhibit good solubility in polar solvents and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the cyclopentyl group may influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with biological targets. N-Cyclopentylethenesulfonamide may also exhibit specific biological activities, making it of interest in pharmaceutical research. As with many sulfonamides, it is essential to consider factors such as stability, toxicity, and environmental impact when evaluating its applications. Overall, this compound represents a versatile structure within the realm of organic and medicinal chemistry, with potential implications in drug development and synthesis.
Formula:C7H13NO2S
InChI:InChI=1S/C7H13NO2S/c1-2-11(9,10)8-7-5-3-4-6-7/h2,7-8H,1,3-6H2
InChI key:InChIKey=VMTQGMPPTPYMTA-UHFFFAOYSA-N
SMILES:N(S(C=C)(=O)=O)C1CCCC1
Synonyms:
  • Ethenesulfonamide, N-cyclopentyl-
  • N-Cyclopentylethenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.