CymitQuimica logo

CAS 104459-82-7

:

methyl ({[(1E)-1-{5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl}-2-methoxyethylidene]amino}oxy)acetate

Description:
Methyl ({[(1E)-1-{5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl}-2-methoxyethylidene]amino}oxy)acetate, with CAS number 104459-82-7, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as an ester, nitro, and ether. This compound typically exhibits moderate to high polarity due to the presence of electronegative atoms like chlorine and nitrogen, which can influence its solubility in various solvents. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. The presence of the trifluoromethyl group may enhance lipophilicity, affecting its interaction with biological membranes. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance is a representative example of a synthetic organic molecule with potential applications in medicinal chemistry and agrochemicals, although specific safety and handling guidelines should be followed due to its complex nature.
Formula:C19H16ClF3N2O7
InChI:InChI=1/C19H16ClF3N2O7/c1-29-9-15(24-31-10-18(26)30-2)13-8-12(4-5-16(13)25(27)28)32-17-6-3-11(7-14(17)20)19(21,22)23/h3-8H,9-10H2,1-2H3/b24-15-
SMILES:COC/C(=N/OCC(=O)OC)/c1cc(ccc1N(=O)=O)Oc1ccc(cc1Cl)C(F)(F)F
Synonyms:
  • ({[(1E)-1-{5-[2-Chloro-4-(trifluorométhyl)phénoxy]-2-nitrophényl}-2-méthoxyéthylidène]amino}oxy)acétate de méthyle
  • 104459-82-7
  • Methyl-({[(1E)-1-{5-[2-chlor-4-(trifluormethyl)phenoxy]-2-nitrophenyl}-2-methoxyethyliden]amino}oxy)acetat
  • Methyl ({[(1E)-1-{5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl}-2-methoxyethylidene]amino}oxy)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.