CAS 104460-70-0

4-Bromo-2-fluoro-5-(trifluoromethyl)benzenamine

Description:

4-Bromo-2-fluoro-5-(trifluoromethyl)benzenamine, with the CAS number 104460-70-0, is an aromatic amine characterized by the presence of a bromine atom, a fluorine atom, and a trifluoromethyl group attached to a benzene ring. This compound features a complex substitution pattern that contributes to its unique chemical properties. The bromine and fluorine substituents enhance its reactivity and influence its electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group is known for imparting lipophilicity and can significantly affect the compound's biological activity and solubility. Additionally, the presence of the amino group (-NH2) allows for further functionalization, making it useful in the synthesis of more complex molecules. Overall, this compound's distinctive structure and substituents make it of interest in fields such as medicinal chemistry and materials science, where it may serve as an intermediate or a building block for more complex chemical entities.

Formula: C₇H₄BrF₄N

InChI: InChI=1S/C7H4BrF4N/c8-4-2-5(9)6(13)1-3(4)7(10,11)12/h1-2H,13H2

InChI key: InChIKey=UYVDMCXPDGRLEC-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Br)C=C(F)C(N)=C1

Synonyms:

• 4-Bromo-2-fluoro-5-(trifluoromethyl)benzenamine
• Benzenamine, 4-bromo-2-fluoro-5-(trifluoromethyl)-
• 4-Bromo-2-fluoro-5-(trifluoromethyl)aniline

4-Bromo-2-fluoro-5-(trifluoromethyl)aniline, 97%

CAS: 104460-70-0

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₇H₄BrF₄N

Purity: 97%

Color and Shape: Pale brown or purple, Crystals or powder or crystalline powder or fused solid

Molecular weight: 258.01

Ref: 02-H31727

4-Bromo-2-fluoro-5-(trifluoromethyl)aniline

CAS: 104460-70-0

Formula: C₇H₄BrF₄N

Purity: 97%

Color and Shape: Liquid

Molecular weight: 258.0110

Ref: IN-DA003KWL

4-Bromo-2-fluoro-5-(trifluoromethyl)aniline

CAS: 104460-70-0

4-Bromo-2-fluoro-5-(trifluoromethyl)aniline

Formula: C₇H₄BrF₄N

Purity: 97%

Color and Shape: almost colourless liquid

Molecular weight: 258.01g/mol

Ref: 54-PC421213

4-Bromo-2-fluoro-5-(trifluoromethyl)aniline

CAS: 104460-70-0

Formula: C₇H₄BrF₄N

Purity: 98%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 258.014

Ref: 10-F013786