CymitQuimica logo

CAS 104460-70-0

:

4-Bromo-2-fluoro-5-(trifluoromethyl)benzenamine

Description:
4-Bromo-2-fluoro-5-(trifluoromethyl)benzenamine, with the CAS number 104460-70-0, is an aromatic amine characterized by the presence of a bromine atom, a fluorine atom, and a trifluoromethyl group attached to a benzene ring. This compound features a complex substitution pattern that contributes to its unique chemical properties. The bromine and fluorine substituents enhance its reactivity and influence its electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group is known for imparting lipophilicity and can significantly affect the compound's biological activity and solubility. Additionally, the presence of the amino group (-NH2) allows for further functionalization, making it useful in the synthesis of more complex molecules. Overall, this compound's distinctive structure and substituents make it of interest in fields such as medicinal chemistry and materials science, where it may serve as an intermediate or a building block for more complex chemical entities.
Formula:C7H4BrF4N
InChI:InChI=1S/C7H4BrF4N/c8-4-2-5(9)6(13)1-3(4)7(10,11)12/h1-2H,13H2
InChI key:InChIKey=UYVDMCXPDGRLEC-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Br)C=C(F)C(N)=C1
Synonyms:
  • 4-Bromo-2-fluoro-5-(trifluoromethyl)benzenamine
  • Benzenamine, 4-bromo-2-fluoro-5-(trifluoromethyl)-
  • 4-Bromo-2-fluoro-5-(trifluoromethyl)aniline
Found 5 products.