CAS 10447-93-5
:1,5-Dimethylimidazole
Description:
1,5-Dimethylimidazole is a heterocyclic organic compound characterized by its five-membered ring structure containing two nitrogen atoms at the 1 and 3 positions. This compound is a derivative of imidazole, featuring two methyl groups attached to the nitrogen atoms at the 1 and 5 positions. It is a colorless to pale yellow liquid with a distinctive odor and is soluble in water and organic solvents. The presence of nitrogen atoms in the ring contributes to its basicity and potential reactivity, making it useful in various chemical applications, including as a ligand in coordination chemistry and as a building block in organic synthesis. Additionally, 1,5-dimethylimidazole can participate in various chemical reactions, such as alkylation and acylation, due to the nucleophilic nature of the nitrogen atoms. Its unique structure and properties make it of interest in both academic research and industrial applications, particularly in the fields of pharmaceuticals and materials science.
Formula:C5H8N2
InChI:InChI=1S/C5H8N2/c1-5-3-6-4-7(5)2/h3-4H,1-2H3
InChI key:InChIKey=HQNBJNDMPLEUDS-UHFFFAOYSA-N
SMILES:CC=1N(C)C=NC1
Synonyms:- 1,5-Dimethylimidazole
- 1H-imidazole, 1,5-dimethyl-
- Imidazole, 1,5-dimethyl-
- N,5-Dimethylimidazole
- 1,5-Dimethyl-1H-imidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,5-dimethyl-1H-imidazole
CAS:1,5-Dimethyl-1H-imidazole is a growth factor that has been shown to induce epidermal growth and inhibit the development of skin tumors in animals. 1,5-Dimethyl-1H-imidazole is a proton donor that can react with histidine residues on the surface of cells to form imidazolium cations. These imidazolium cations are then able to bind to and activate epidermal growth factor receptors (EGFRs) on the cell surface. This leads to activation of the EGFR signaling pathway and subsequent production of proteins involved in cell proliferation, differentiation, and survival. 1,5-Dimethyl-1H-imidazole also binds metal ions such as iron or copper, which may be important for its activity against cancer cells.
Formula:C5H8N2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:96.13 g/mol

