
CAS 1044749-60-1
:2-Methyl-8-(trifluoromethyl)-4H-3,1-benzoxazin-4-one
Description:
2-Methyl-8-(trifluoromethyl)-4H-3,1-benzoxazin-4-one is a synthetic organic compound characterized by its unique benzoxazine structure, which includes a benzene ring fused to a heterocyclic oxazine moiety. This compound features a methyl group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. The benzoxazine framework is known for its potential applications in polymer science and as a precursor for various functional materials. Additionally, the compound may exhibit interesting photophysical properties due to its conjugated system, which could be relevant in the development of dyes or sensors. Its CAS number, 1044749-60-1, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and materials science. Overall, this compound represents a versatile structure with potential utility in diverse chemical applications.
Formula:C10H6F3NO2
InChI:InChI=1S/C10H6F3NO2/c1-5-14-8-6(9(15)16-5)3-2-4-7(8)10(11,12)13/h2-4H,1H3
InChI key:InChIKey=FOYFYCONBLTFKL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(C(=O)OC(C)=N2)=CC=C1
Synonyms:- 2-Methyl-8-(trifluoromethyl)-4H-3,1-benzoxazin-4-one
- 4H-3,1-Benzoxazin-4-one, 2-methyl-8-(trifluoromethyl)-
- 2-Methyl-8-(trifluoromethyl)-4H-benzo[d][1,3]oxazin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.