CAS 1044765-31-2

3-(2,6-Dimethylphenyl)pyrrolidine

Description:

3-(2,6-Dimethylphenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of the 2,6-dimethylphenyl group introduces significant steric and electronic effects, influencing the compound's reactivity and interaction with biological systems. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in organic solvents, which is common for many nitrogen-containing heterocycles. The compound may exhibit interesting pharmacological properties due to its structural features, potentially interacting with various biological targets. Its synthesis often involves the alkylation of pyrrolidine or related reactions, and it may be used in research settings to explore its effects in medicinal chemistry or as a building block in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₂H₁₇N

InChI: InChI=1S/C12H17N/c1-9-4-3-5-10(2)12(9)11-6-7-13-8-11/h3-5,11,13H,6-8H2,1-2H3

InChI key: InChIKey=NKOJVKDTBOVCOZ-UHFFFAOYSA-N

SMILES: CC1=C(C(C)=CC=C1)C2CCNC2

Synonyms:

• Pyrrolidine, 3-(2,6-dimethylphenyl)-
• 3-(2,6-Dimethylphenyl)pyrrolidine