CymitQuimica logo

CAS 1044765-33-4

:

3-(2,3-Difluorophenyl)piperidine

Description:
3-(2,3-Difluorophenyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2,3-difluorophenyl group attached to the piperidine ring significantly influences its chemical properties and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of both polar and nonpolar functional groups. The difluorophenyl moiety introduces electron-withdrawing fluorine atoms, which can affect the compound's reactivity and interaction with biological targets. As a piperidine derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry for potential therapeutic applications. The compound's structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in various chemical environments. Safety data and handling precautions should be considered, as with any chemical substance, particularly in research and industrial applications.
Formula:C11H13F2N
InChI:InChI=1S/C11H13F2N/c12-10-5-1-4-9(11(10)13)8-3-2-6-14-7-8/h1,4-5,8,14H,2-3,6-7H2
InChI key:InChIKey=JYGMKVCYGBCLEO-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1F)C2CCCNC2
Synonyms:
  • 3-(2,3-Difluorophenyl)piperidine
  • Piperidine, 3-(2,3-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.