CAS 1044766-10-0

5-(2-Bromophenyl)-1,3,4-oxadiazol-2(3H)-one

Description:

5-(2-Bromophenyl)-1,3,4-oxadiazol-2(3H)-one is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. The compound features a bromophenyl substituent, indicating the presence of a bromine atom attached to a phenyl group, which can influence its reactivity and solubility. This compound is typically solid at room temperature and may exhibit moderate to high stability under standard conditions. Its structure suggests potential applications in pharmaceuticals or agrochemicals, as oxadiazoles are known for their biological activity. The presence of the bromine atom can enhance the compound's lipophilicity, potentially affecting its interaction with biological targets. Additionally, the compound may exhibit fluorescence or other optical properties, making it of interest in materials science. As with many heterocycles, its reactivity can be influenced by the electronic effects of the substituents, making it a candidate for further chemical modifications or derivatizations.

Formula: C₈H₅BrN₂O₂

InChI: InChI=1S/C8H5BrN2O2/c9-6-4-2-1-3-5(6)7-10-11-8(12)13-7/h1-4H,(H,11,12)

InChI key: InChIKey=LLXKEYIVXPRCCF-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC=C1)C=2OC(=O)NN2

Synonyms:

• 5-(2-Bromophenyl)-1,3,4-oxadiazol-2(3H)-one
• 1,3,4-Oxadiazol-2(3H)-one, 5-(2-bromophenyl)-