CAS 1044766-91-7
:1-[(3-Hydroxyphenyl)methyl]-3-piperidinecarboxylic acid
Description:
1-[(3-Hydroxyphenyl)methyl]-3-piperidinecarboxylic acid, identified by its CAS number 1044766-91-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a hydroxyl group attached to a phenyl ring, contributing to its potential for hydrogen bonding and influencing its solubility and reactivity. The carboxylic acid functional group enhances its acidity and polar characteristics, making it soluble in polar solvents. The presence of both the hydroxyl and carboxylic acid groups suggests that this compound may exhibit biological activity, potentially interacting with various biological targets. Its structural features may also allow for various synthetic modifications, making it of interest in medicinal chemistry and drug development. Overall, this compound's unique combination of functional groups and ring structure positions it as a candidate for further research in pharmacological applications.
Formula:C13H17NO3
InChI:InChI=1S/C13H17NO3/c15-12-5-1-3-10(7-12)8-14-6-2-4-11(9-14)13(16)17/h1,3,5,7,11,15H,2,4,6,8-9H2,(H,16,17)
InChI key:InChIKey=XMLHPJFWKPXYDO-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CCC1)C2=CC(O)=CC=C2
Synonyms:- 3-Piperidinecarboxylic acid, 1-[(3-hydroxyphenyl)methyl]-
- 1-[(3-Hydroxyphenyl)methyl]-3-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.