CAS 1044768-67-3

3-(2,4-Difluorophenyl)piperidine

Description:

3-(2,4-Difluorophenyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2,4-difluorophenyl group attached to the piperidine at the third position significantly influences its chemical properties and biological activity. This compound typically exhibits moderate to high lipophilicity due to the aromatic fluorinated substituents, which can enhance its ability to penetrate biological membranes. The difluorophenyl moiety may also contribute to its potential as a pharmacophore in medicinal chemistry, particularly in the development of pharmaceuticals targeting various neurological and psychiatric disorders. Additionally, the presence of fluorine atoms can affect the compound's metabolic stability and reactivity. As with many piperidine derivatives, 3-(2,4-Difluorophenyl)piperidine may exhibit interesting interactions with biological targets, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₁H₁₃F₂N

InChI: InChI=1S/C11H13F2N/c12-9-3-4-10(11(13)6-9)8-2-1-5-14-7-8/h3-4,6,8,14H,1-2,5,7H2

InChI key: InChIKey=AYNGMIKWZWTBGI-UHFFFAOYSA-N

SMILES: FC1=C(C2CCCNC2)C=CC(F)=C1

Synonyms:

• 3-(2,4-Difluorophenyl)piperidine
• Piperidine, 3-(2,4-difluorophenyl)-