
CAS 1044768-68-4
:3-(3-Chloro-4-fluorophenyl)piperidine
Description:
3-(3-Chloro-4-fluorophenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a 3-chloro-4-fluorophenyl group indicates that the compound has both chlorine and fluorine substituents on the aromatic ring, contributing to its unique chemical properties. This compound is typically classified as an organic amine and may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The presence of halogens like chlorine and fluorine often enhances lipophilicity and metabolic stability, influencing the compound's pharmacokinetics. Additionally, the compound's solubility, reactivity, and stability can be affected by the substituents on the aromatic ring. Overall, 3-(3-Chloro-4-fluorophenyl)piperidine is a compound of interest for further research, particularly in the context of its potential applications in pharmaceuticals.
Formula:C11H13ClFN
InChI:InChI=1S/C11H13ClFN/c12-10-6-8(3-4-11(10)13)9-2-1-5-14-7-9/h3-4,6,9,14H,1-2,5,7H2
InChI key:InChIKey=CTYSRALMWGTHAT-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1F)C2CCCNC2
Synonyms:- Piperidine, 3-(3-chloro-4-fluorophenyl)-
- 3-(3-Chloro-4-fluorophenyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.