
CAS 1044768-75-3
:3-(4-Chloro-2-fluorophenyl)piperidine
Description:
3-(4-Chloro-2-fluorophenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The compound features a phenyl group substituted with both a chlorine atom and a fluorine atom at specific positions, contributing to its unique chemical properties. The presence of these halogen substituents can influence the compound's reactivity, lipophilicity, and biological activity. Typically, compounds like this may exhibit potential pharmacological properties, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it may interact with various biological targets, potentially serving as a lead compound for further modifications. Additionally, the compound's stability, solubility, and overall behavior in different environments can be influenced by the electronic effects of the halogen substituents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H13ClFN
InChI:InChI=1S/C11H13ClFN/c12-9-3-4-10(11(13)6-9)8-2-1-5-14-7-8/h3-4,6,8,14H,1-2,5,7H2
InChI key:InChIKey=FVLCTSOPIVUNMQ-UHFFFAOYSA-N
SMILES:FC1=C(C2CCCNC2)C=CC(Cl)=C1
Synonyms:- 3-(4-Chloro-2-fluorophenyl)piperidine
- Piperidine, 3-(4-chloro-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.