CAS 1044768-78-6

3-(2-Fluoro-4-methoxyphenyl)piperidine

Description:

3-(2-Fluoro-4-methoxyphenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a 2-fluoro-4-methoxyphenyl substituent, indicating the presence of a fluorine atom and a methoxy group (-OCH3) on the aromatic ring. This structure contributes to its potential biological activity, as modifications on the phenyl ring can influence pharmacological properties. The presence of the fluorine atom may enhance lipophilicity and metabolic stability, while the methoxy group can affect the compound's electronic properties and sterics. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. As with many piperidine derivatives, it may exhibit interactions with neurotransmitter systems, making it of interest in drug discovery. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₆FNO

InChI: InChI=1S/C12H16FNO/c1-15-10-4-5-11(12(13)7-10)9-3-2-6-14-8-9/h4-5,7,9,14H,2-3,6,8H2,1H3

InChI key: InChIKey=QUFJICMSLHNMEG-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(OC)=C1)C2CCCNC2

Synonyms:

• Piperidine, 3-(2-fluoro-4-methoxyphenyl)-
• 3-(2-Fluoro-4-methoxyphenyl)piperidine