CymitQuimica logo

CAS 1044768-80-0

:

3-(2-Fluoro-5-methylphenyl)piperidine

Description:
3-(2-Fluoro-5-methylphenyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2-fluoro-5-methylphenyl group indicates that a fluorine atom and a methyl group are substituted on a phenyl ring, influencing the compound's chemical properties and reactivity. This compound is typically classified as an aromatic amine due to the piperidine structure and the phenyl substituent. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as modifications to the piperidine and phenyl groups can significantly affect biological activity. The fluorine atom may enhance lipophilicity and metabolic stability, while the methyl group can influence steric hindrance and electronic properties. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety data and handling precautions should be consulted when working with this compound, as it may exhibit specific hazards typical of nitrogen-containing organic substances.
Formula:C12H16FN
InChI:InChI=1S/C12H16FN/c1-9-4-5-12(13)11(7-9)10-3-2-6-14-8-10/h4-5,7,10,14H,2-3,6,8H2,1H3
InChI key:InChIKey=CHZXPHBMMGKCNO-UHFFFAOYSA-N
SMILES:FC1=C(C=C(C)C=C1)C2CCCNC2
Synonyms:
  • 3-(2-Fluoro-5-methylphenyl)piperidine
  • Piperidine, 3-(2-fluoro-5-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.