
CAS 1044768-91-3
:3-(2-Chloro-5-methylphenyl)piperidine
Description:
3-(2-Chloro-5-methylphenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The structure features a 2-chloro-5-methylphenyl group attached to the third position of the piperidine ring, contributing to its unique properties. This compound is typically classified as an organic amine and may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to pharmacological effects. The presence of the chlorine atom and the methyl group on the phenyl ring can influence its lipophilicity, solubility, and overall reactivity. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of its structure. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C12H16ClN
InChI:InChI=1S/C12H16ClN/c1-9-4-5-12(13)11(7-9)10-3-2-6-14-8-10/h4-5,7,10,14H,2-3,6,8H2,1H3
InChI key:InChIKey=FWJVYSLHIMVWRW-UHFFFAOYSA-N
SMILES:ClC1=C(C=C(C)C=C1)C2CCCNC2
Synonyms:- 3-(2-Chloro-5-methylphenyl)piperidine
- Piperidine, 3-(2-chloro-5-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.