CAS 1044768-94-6

3-(4-Chloro-2-methylphenyl)piperidine

Description:

3-(4-Chloro-2-methylphenyl)piperidine, identified by its CAS number 1044768-94-6, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a 4-chloro-2-methylphenyl substituent, indicating the presence of a chlorine atom and a methyl group on a phenyl ring at specific positions. This structure suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The presence of the chloro and methyl groups can influence the compound's lipophilicity, solubility, and interaction with biological targets. Typically, such compounds may exhibit properties relevant to neuropharmacology, making them of interest in the development of therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would require experimental determination or literature reference for precise values. Safety and handling considerations should also be taken into account, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₂H₁₆ClN

InChI: InChI=1S/C12H16ClN/c1-9-7-11(13)4-5-12(9)10-3-2-6-14-8-10/h4-5,7,10,14H,2-3,6,8H2,1H3

InChI key: InChIKey=NUVMYCYYEGZGRH-UHFFFAOYSA-N

SMILES: CC1=C(C2CCCNC2)C=CC(Cl)=C1

Synonyms:

• 3-(4-Chloro-2-methylphenyl)piperidine
• Piperidine, 3-(4-chloro-2-methylphenyl)-