CymitQuimica logo

CAS 1044768-95-7

:

2-Fluoro-5-(3-piperidinyl)benzonitrile

Description:
2-Fluoro-5-(3-piperidinyl)benzonitrile is a chemical compound characterized by its structural features, which include a fluorine atom and a piperidine ring attached to a benzonitrile moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The piperidine group, a six-membered ring containing one nitrogen atom, is known for its role in various pharmacological applications, often contributing to the compound's ability to interact with biological targets. This compound may exhibit properties such as moderate to high solubility in organic solvents, depending on the specific functional groups and their arrangement. It is important to note that compounds like this can be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential activity against specific biological pathways. Safety and handling precautions should be observed, as with any chemical substance, and its use should be guided by relevant regulatory and safety guidelines.
Formula:C12H13FN2
InChI:InChI=1S/C12H13FN2/c13-12-4-3-9(6-11(12)7-14)10-2-1-5-15-8-10/h3-4,6,10,15H,1-2,5,8H2
InChI key:InChIKey=NNJIPJCASGWKAM-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1F)C2CCCNC2
Synonyms:
  • Benzonitrile, 2-fluoro-5-(3-piperidinyl)-
  • 2-Fluoro-5-(3-piperidinyl)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.