CAS 1044769-14-3

3-(2-Chloro-4-fluorophenyl)piperidine

Description:

3-(2-Chloro-4-fluorophenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The compound features a phenyl group substituted with both a chlorine and a fluorine atom at specific positions, contributing to its unique chemical properties. The presence of these halogen substituents can influence the compound's reactivity, lipophilicity, and biological activity. Typically, such compounds may exhibit potential pharmacological properties, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it may interact with various biological targets, potentially affecting neurotransmitter systems. Additionally, the compound's stability, solubility, and overall behavior in different environments can be influenced by the electronic effects of the halogen atoms. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 3-(2-Chloro-4-fluorophenyl)piperidine represents a class of compounds that could have significant implications in pharmaceutical research.

Formula: C₁₁H₁₃ClFN

InChI: InChI=1S/C11H13ClFN/c12-11-6-9(13)3-4-10(11)8-2-1-5-14-7-8/h3-4,6,8,14H,1-2,5,7H2

InChI key: InChIKey=MDEPMUVBWPEFCP-UHFFFAOYSA-N

SMILES: ClC1=C(C2CCCNC2)C=CC(F)=C1

Synonyms:

• Piperidine, 3-(2-chloro-4-fluorophenyl)-
• 3-(2-Chloro-4-fluorophenyl)piperidine