CymitQuimica logo

CAS 1044769-15-4

:

3-(3-Chloro-5-fluorophenyl)piperidine

Description:
3-(3-Chloro-5-fluorophenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The compound features a phenyl group substituted with both chlorine and fluorine atoms, specifically at the 3 and 5 positions, respectively. This substitution pattern can influence the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. The presence of halogens, such as chlorine and fluorine, often enhances the compound's metabolic stability and can affect its interaction with biological targets. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric disorders. Additionally, the compound's properties, such as solubility, boiling point, and reactivity, would be influenced by the functional groups present and their spatial arrangement. As with any chemical substance, safety data and handling precautions should be considered, especially given the presence of halogenated groups, which may pose environmental and health risks.
Formula:C11H13ClFN
InChI:InChI=1S/C11H13ClFN/c12-10-4-9(5-11(13)6-10)8-2-1-3-14-7-8/h4-6,8,14H,1-3,7H2
InChI key:InChIKey=CAFMVXFQMXDUDP-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(F)C1)C2CCCNC2
Synonyms:
  • Piperidine, 3-(3-chloro-5-fluorophenyl)-
  • 3-(3-Chloro-5-fluorophenyl)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.