CymitQuimica logo

CAS 1044770-17-3

:

1-(2-Furanylmethyl)-3-piperidinol

Description:
1-(2-Furanylmethyl)-3-piperidinol is a chemical compound characterized by its unique structure, which includes a piperidine ring and a furan moiety. The presence of the furan group contributes to its potential reactivity and biological activity, as furan derivatives are known for their involvement in various chemical reactions, including electrophilic substitutions. The piperidinol portion of the molecule indicates that it possesses a hydroxyl group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the synthesis of compounds with neuroactive or analgesic properties. Additionally, the compound's stability, reactivity, and interaction with biological systems would be influenced by factors such as pH and the presence of other functional groups. Overall, 1-(2-Furanylmethyl)-3-piperidinol represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c12-9-3-1-5-11(7-9)8-10-4-2-6-13-10/h2,4,6,9,12H,1,3,5,7-8H2
InChI key:InChIKey=XCJYXVRJOWHGNN-UHFFFAOYSA-N
SMILES:C(N1CC(O)CCC1)C2=CC=CO2
Synonyms:
  • 3-Piperidinol, 1-(2-furanylmethyl)-
  • 1-(2-Furanylmethyl)-3-piperidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.