
CAS 1044772-75-9
:Ethyl 5-chloro-3H-imidazo[4,5-b]pyridine-2-carboxylate
Description:
Ethyl 5-chloro-3H-imidazo[4,5-b]pyridine-2-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a chloro substituent and an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring system. The presence of the chloro group can influence its reactivity and solubility, while the ethyl ester moiety may enhance its lipophilicity, potentially affecting its pharmacokinetic properties. Ethyl 5-chloro-3H-imidazo[4,5-b]pyridine-2-carboxylate may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many heterocyclic compounds, it may also exhibit unique reactivity patterns, making it a subject of interest in various chemical research fields.
Formula:C9H8ClN3O2
InChI:InChI=1S/C9H8ClN3O2/c1-2-15-9(14)8-11-5-3-4-6(10)12-7(5)13-8/h3-4H,2H2,1H3,(H,11,12,13)
InChI key:InChIKey=HJXGNUPEACAWBG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC=2C(N1)=CC=C(Cl)N2
Synonyms:- Ethyl 5-chloro-3H-imidazo[4,5-b]pyridine-2-carboxylate
- 3H-Imidazo[4,5-b]pyridine-2-carboxylic acid, 5-chloro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.