CAS 104478-99-1

N-(4-amino-2-methylphenyl)benzamide

Description:

N-(4-amino-2-methylphenyl)benzamide, also known by its CAS number 104478-99-1, is an organic compound characterized by the presence of both an amine and an amide functional group. This compound features a benzene ring substituted with an amino group at the para position and a methyl group at the ortho position relative to the amino group. The amide functionality is derived from the attachment of a benzoyl group to the nitrogen of the amino group. This structure contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Additionally, the presence of both polar and non-polar regions in its molecular structure may influence its interactions with other molecules, making it relevant in various chemical and biological applications.

Formula: C₁₄H₁₄N₂O

InChI: InChI=1S/C14H14N2O/c1-10-9-12(15)7-8-13(10)16-14(17)11-5-3-2-4-6-11/h2-9H,15H2,1H3,(H,16,17)

InChI key: InChIKey=NBDOSEUNJLCDLN-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CC=C1)C2=C(C)C=C(N)C=C2

Synonyms:

• benzamide, N-(4-amino-2-methylphenyl)-
• N-(4-Amino-2-methylphenyl)benzamide