CAS 10448-26-7
:Hexyl decanoate
Description:
Hexyl decanoate, with the CAS number 10448-26-7, is an ester formed from hexanol and decanoic acid. It is characterized by its pleasant, fruity odor, making it useful in the fragrance and flavoring industries. This compound is typically a colorless to pale yellow liquid that is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. Hexyl decanoate has a relatively low volatility, which contributes to its stability in various applications. Its molecular structure consists of a long hydrocarbon chain, which imparts characteristics such as low reactivity and a degree of hydrophobicity. In terms of physical properties, it generally exhibits a moderate boiling point and a low density compared to water. Hexyl decanoate is often utilized in cosmetic formulations, food additives, and as a solvent in chemical processes. Safety data indicates that it should be handled with care, as with many organic compounds, to avoid potential irritation or adverse effects upon exposure.
Formula:C16H32O2
InChI:InChI=1S/C16H32O2/c1-3-5-7-9-10-11-12-14-16(17)18-15-13-8-6-4-2/h3-15H2,1-2H3
InChI key:InChIKey=DGPNTCACXCHFDI-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)(OCCCCCC)=O
Synonyms:- Decanoic acid, hexyl ester
- Hexyl caprate
- Hexyl decanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hexyl decanoate
CAS:Hexyl decanoate, the first trail pheromone compound identified in a stingless bee, Trigona recursa. Hexyl decanoate is dominant component of gland secretions.Formula:C16H32O2Color and Shape:SolidMolecular weight:256.42
