CAS 104481-24-5
:2-(1-Piperazinyl)-4-thiazolecarboxylic acid ethyl ester
Description:
2-(1-Piperazinyl)-4-thiazolecarboxylic acid ethyl ester, with the CAS number 104481-24-5, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the piperazine group suggests possible interactions with biological targets, particularly in the central nervous system, while the thiazole ring may contribute to its pharmacological properties. The ethyl ester functionality indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may enhance its reactivity and biological activity. Overall, this compound's characteristics, including its molecular structure and functional groups, position it as a candidate for further investigation in medicinal chemistry and drug development.
Formula:C10H15N3O2S
InChI:InChI=1/C10H15N3O2S/c1-2-15-9(14)8-7-16-10(12-8)13-5-3-11-4-6-13/h7,11H,2-6H2,1H3
SMILES:CCOC(=O)c1csc(n1)N1CCNCC1
Synonyms:- 4-Thiazolecarboxylic Acid, 2-(1-Piperazinyl)-, Ethyl Ester
- Ethyl 2-(piperazin-1-yl)-1,3-thiazole-4-carboxylate
- Ethyl 2-Piperazin-1-Ylthiazole-4-Carboxylate
- Ethyl 2-(Piperazin-1-Yl)Thiazole-4-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
