CAS 10449-66-8
:5-Methoxy-2(5H)-furanone
Description:
5-Methoxy-2(5H)-furanone, also known as maltol, is an organic compound characterized by its furanone structure, which features a five-membered lactone ring containing both oxygen and carbon atoms. This compound is typically a colorless to pale yellow liquid with a sweet, caramel-like aroma, making it valuable in the food and fragrance industries as a flavoring agent. It is soluble in organic solvents and exhibits moderate solubility in water. The presence of the methoxy group contributes to its reactivity and potential applications in organic synthesis. 5-Methoxy-2(5H)-furanone is known for its antioxidant properties and has been studied for its potential health benefits, including anti-inflammatory and antimicrobial effects. Its stability under various conditions makes it suitable for use in various formulations. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound is notable for its sensory attributes and versatility in both culinary and pharmaceutical applications.
Formula:C5H6O3
InChI:InChI=1S/C5H6O3/c1-7-5-3-2-4(6)8-5/h2-3,5H,1H3
InChI key:InChIKey=LRHFWTSUYLXTPU-UHFFFAOYSA-N
SMILES:O(C)C1OC(=O)C=C1
Synonyms:- (±)-5-Methoxy-2(5H)-furanone
- 2(5H)-Furanone, 5-methoxy-
- 2-Methoxy-5-oxo-2,5-dihydrofuran
- 4-Methoxy-2-butenolide
- 4-Methoxybutenolide
- 5-Methoxy-2(3)-dihydrofuranone
- Crotonic acid, 4-hydroxy-4-methoxy-, γ-lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.