CAS 1044924-10-8

4-Piperidinol, 1-[(4-bromo-2-fluorophenyl)methyl]-

Description:

4-Piperidinol, 1-[(4-bromo-2-fluorophenyl)methyl]- is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a hydroxyl group (-OH) at the 4-position of the piperidine, contributing to its classification as a piperidinol. The presence of a 4-bromo-2-fluorophenyl group at the 1-position indicates that it has both bromine and fluorine substituents on the aromatic ring, which can influence its reactivity and biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's unique halogen substitutions may enhance its binding affinity to biological targets. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific interactions of its functional groups and overall molecular structure. Safety and handling precautions should be observed, as with any chemical substance.

Formula: C₁₂H₁₅BrFNO

InChI: InChI=1S/C12H15BrFNO/c13-10-2-1-9(12(14)7-10)8-15-5-3-11(16)4-6-15/h1-2,7,11,16H,3-6,8H2

InChI key: InChIKey=ZYMAHRVUIFWGOB-UHFFFAOYSA-N

SMILES: C(C1=C(F)C=C(Br)C=C1)N2CCC(O)CC2

Synonyms:

• 1-[(4-Bromo-2-fluorophenyl)methyl]piperidin-4-ol
• 4-Piperidinol, 1-[(4-bromo-2-fluorophenyl)methyl]-