CymitQuimica logo

CAS 104499-47-0

:

N-(4-methoxybenzyl)-N'-methyl-N-(pyridin-2-yl)ethane-1,2-diamine

Description:
N-(4-methoxybenzyl)-N'-methyl-N-(pyridin-2-yl)ethane-1,2-diamine is a chemical compound characterized by its complex structure, which includes an ethane backbone with two amine groups and various substituents. The presence of a methoxy group on the benzyl moiety enhances its lipophilicity, potentially influencing its biological activity and solubility. The pyridine ring contributes to the compound's aromatic character and may participate in hydrogen bonding or coordination with metal ions. This compound is likely to exhibit basic properties due to the amine functionalities, which can accept protons. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's unique combination of functional groups may allow for interactions with various biological targets, making it of interest in research related to drug design and synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H21N3O
InChI:InChI=1/C16H21N3O/c1-17-11-12-19(16-5-3-4-10-18-16)13-14-6-8-15(20-2)9-7-14/h3-10,17H,11-13H2,1-2H3
SMILES:CNCCN(Cc1ccc(cc1)OC)c1ccccn1
Synonyms:
  • 1,2-ethanediamine, N~1~-[(4-methoxyphenyl)methyl]-N~2~-methyl-N~1~-2-pyridinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.