CymitQuimica logo

CAS 104503-68-6

:

3,6,9,12,15,18,21-Heptaoxatetratriacontanoic acid, sodium salt (1:1)

Description:
3,6,9,12,15,18,21-Heptaoxatetratriacontanoic acid, sodium salt (1:1) is a complex chemical compound characterized by its long carbon chain and multiple ether linkages, which contribute to its unique properties. This substance is a sodium salt of a fatty acid, indicating that it is likely soluble in water and exhibits surfactant properties. The presence of multiple oxygen atoms in its structure suggests that it may have hydrophilic characteristics, making it useful in various applications, including emulsification and stabilization in formulations. Its molecular structure implies potential uses in the fields of pharmaceuticals, cosmetics, and materials science, where it may serve as a surfactant or a stabilizing agent. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C27H54O9·Na
InChI:InChI=1S/C27H54O9.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-30-14-15-31-16-17-32-18-19-33-20-21-34-22-23-35-24-25-36-26-27(28)29;/h2-26H2,1H3,(H,28,29);
InChI key:InChIKey=NSTPEJJJTVLUGD-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCCCCCCCCCCCC)CCOCCOCCOCC(O)=O.[Na]
Synonyms:
  • 3,6,9,12,15,18,21-Heptaoxatetratriacontanoic acid, sodium salt (1:1)
  • 3,6,9,12,15,18,21-Heptaoxatetratriacontanoic acid, sodium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.