
CAS 104540-39-8
:5-(Methoxymethyl)-2,4-imidazolidinedione
Description:
5-(Methoxymethyl)-2,4-imidazolidinedione, with the CAS number 104540-39-8, is a chemical compound characterized by its imidazolidinedione structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in polar organic solvents. The methoxymethyl group enhances its reactivity and solubility profile, making it useful in various chemical applications, including as an intermediate in organic synthesis. The presence of the imidazolidinedione moiety suggests potential biological activity, which may include antimicrobial or antifungal properties, although specific biological data may vary. Its stability under standard conditions allows for its use in laboratory settings, but it should be handled with care due to potential reactivity with strong nucleophiles. Overall, 5-(Methoxymethyl)-2,4-imidazolidinedione is a versatile compound with applications in medicinal chemistry and organic synthesis.
Formula:C5H8N2O3
InChI:InChI=1S/C5H8N2O3/c1-10-2-3-4(8)7-5(9)6-3/h3H,2H2,1H3,(H2,6,7,8,9)
InChI key:InChIKey=BBSQTQNQEAVBFC-UHFFFAOYSA-N
SMILES:C(OC)C1C(=O)NC(=O)N1
Synonyms:- 5-(Methoxymethyl)-2,4-imidazolidinedione
- 2,4-Imidazolidinedione, 5-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.