CAS 104553-43-7
:(S)-PYRROLIDIN-2-YL-ACETIC ACID TERT-BUTYL ESTER
Description:
(S)-Pyrrolidin-2-yl-acetic acid tert-butyl ester is a chiral compound characterized by its pyrrolidine ring structure, which contributes to its biological activity and potential applications in pharmaceuticals. This compound features a tert-butyl ester group, enhancing its lipophilicity and stability, which can influence its solubility and permeability in biological systems. The presence of the acetic acid moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. As a chiral molecule, it exists in two enantiomeric forms, with the (S)-configuration often being associated with specific pharmacological effects. The compound is typically synthesized through esterification reactions and may be used in various applications, including drug development and synthesis of biologically active molecules. Its CAS number, 104553-43-7, allows for easy identification and reference in chemical databases. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C10H19NO2
InChI:InChI=1/C10H19NO2/c1-10(2,3)13-9(12)7-8-5-4-6-11-8/h8,11H,4-7H2,1-3H3/t8-/m0/s1
SMILES:CC(C)(C)OC(=O)C[C@@H]1CCCN1
Synonyms:- 2-pyrrolidineacetic acid, 1,1-dimethylethyl ester, (2S)-
- tert-Butyl (2S)-pyrrolidin-2-ylacetate
- tert-Butyl-(2S)-pyrrolidin-2-ylacetat
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
