CymitQuimica logo

CAS 104580-74-7

:

Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-4-carboxylate

Description:
Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-4-carboxylate, with the CAS number 104580-74-7, is a chemical compound characterized by its complex bicyclic structure, which incorporates both indole and pyridine moieties. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. It is often studied for its pharmacological properties, particularly in the context of neurochemistry and medicinal chemistry, as it may interact with various biological targets. The presence of the carboxylate group suggests it may participate in acid-base reactions and could be involved in forming esters or amides. Additionally, the methyl ester functionality indicates that it may be more lipophilic, potentially influencing its solubility and permeability in biological systems. Overall, this compound's unique structure and functional groups make it of interest in both synthetic and medicinal chemistry research.
Formula:C13H14N2O2
InChI:InChI=1S/C13H14N2O2/c1-17-13(16)9-6-14-7-11-12(9)8-4-2-3-5-10(8)15-11/h2-5,9,14-15H,6-7H2,1H3
InChI key:InChIKey=YOOXDTWCCSMAOZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C=2C=3C(NC2CNC1)=CC=CC3
Synonyms:
  • 1H-Pyrido[3,4-b]indole-4-carboxylic acid, 2,3,4,9-tetrahydro-, methyl ester, (±)-
  • 1H-Pyrido[3,4-b]indole-4-carboxylic acid, 2,3,4,9-tetrahydro-, methyl ester
  • Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.