CAS 104582-29-8
:3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethyldisulfanyl]propanoic acid
Description:
The chemical substance known as 3-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethyldisulfanyl]propanoic acid, with the CAS number 104582-29-8, is a complex organic compound characterized by its unique structural features. It contains a thieno[3,4-d]imidazole core, which contributes to its potential biological activity. The presence of a disulfide bond in its structure suggests that it may participate in redox reactions, which can be significant in biochemical processes. Additionally, the compound features an amino acid derivative, indicating potential applications in medicinal chemistry, particularly in drug design or as a biochemical probe. Its stereochemistry, denoted by the specific configuration at certain chiral centers, may influence its interaction with biological targets. Overall, this compound's intricate structure and functional groups suggest it may exhibit interesting pharmacological properties, warranting further investigation in the fields of biochemistry and medicinal chemistry.
Formula:C15H25N3O4S3
InChI:InChI=1/C15H25N3O4S3/c19-12(16-6-8-25-24-7-5-13(20)21)4-2-1-3-11-14-10(9-23-11)17-15(22)18-14/h10-11,14H,1-9H2,(H,16,19)(H,20,21)(H2,17,18,22)/t10-,11-,14-/m0/s1
SMILES:C(CCC(=NCCSSCCC(=O)O)O)C[C@H]1[C@@H]2[C@H](CS1)N=C(N2)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[2-N-(Biotinyl)aminoethyldithio]propanoic Acid
CAS:Controlled ProductApplications 3-[2-N-(Biotinyl)aminoethyldithio]propanoic Acid (cas# 104582-29-8) is a compound useful in organic synthesis.
References Kobayashi, N., et al.: Anal. Biochem., 357, 311 (2006),Formula:C15H25N3O4S3Color and Shape:NeatMolecular weight:407.57
