CAS 1045855-19-3

1,1-Dimethylethyl 3,4-dihydro-5-methoxy-1,7-naphthyridine-1(2H)-carboxylate

Description:

1,1-Dimethylethyl 3,4-dihydro-5-methoxy-1,7-naphthyridine-1(2H)-carboxylate, identified by its CAS number 1045855-19-3, is a chemical compound characterized by its complex structure, which includes a naphthyridine core. This compound features a methoxy group and a tert-butyl group, contributing to its unique chemical properties. It is typically classified as an organic compound and may exhibit biological activity, making it of interest in medicinal chemistry. The presence of the carboxylate functional group suggests potential for reactivity and interactions with various biological targets. Its molecular structure may influence its solubility, stability, and reactivity, which are critical factors in its application in pharmaceuticals or agrochemicals. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, this compound represents a specific class of naphthyridine derivatives that may have implications in drug development or other chemical applications.

Formula: C₁₄H₂₀N₂O₃

InChI: InChI=1S/C14H20N2O3/c1-14(2,3)19-13(17)16-7-5-6-10-11(16)8-15-9-12(10)18-4/h8-9H,5-7H2,1-4H3

InChI key: InChIKey=QYTKKHXFJPMETM-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C=2C(=C(OC)C=NC2)CCC1

Synonyms:

• 1,1-Dimethylethyl 3,4-dihydro-5-methoxy-1,7-naphthyridine-1(2H)-carboxylate
• 1,7-Naphthyridine-1(2H)-carboxylic acid, 3,4-dihydro-5-methoxy-, 1,1-dimethylethyl ester