CAS 1045858-10-3
:1,1-Dimethylethyl N-(5-methoxy-4-methyl-3-pyridinyl)carbamate
Description:
1,1-Dimethylethyl N-(5-methoxy-4-methyl-3-pyridinyl)carbamate, identified by its CAS number 1045858-10-3, is a chemical compound that belongs to the class of carbamates. This substance features a pyridine ring substituted with methoxy and methyl groups, contributing to its unique chemical properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its reactivity and solubility. Carbamates are known for their applications in agriculture as pesticides and herbicides, as well as in pharmaceuticals. The specific structure of this compound suggests potential biological activity, possibly acting as an inhibitor or modulator in various biochemical pathways. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in medicinal chemistry and agrochemical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C12H18N2O3
InChI:InChI=1S/C12H18N2O3/c1-8-9(6-13-7-10(8)16-5)14-11(15)17-12(2,3)4/h6-7H,1-5H3,(H,14,15)
InChI key:InChIKey=MLXHDVCEKKKMHN-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C=1C(C)=C(OC)C=NC1
Synonyms:- 1,1-Dimethylethyl N-(5-methoxy-4-methyl-3-pyridinyl)carbamate
- Carbamic acid, N-(5-methoxy-4-methyl-3-pyridinyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
