CymitQuimica logo

CAS 1045858-18-1

:

1,1-Dimethylethyl N-[5-methoxy-4-(trimethylsilyl)-3-pyridinyl]carbamate

Description:
1,1-Dimethylethyl N-[5-methoxy-4-(trimethylsilyl)-3-pyridinyl]carbamate, identified by its CAS number 1045858-18-1, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a pyridine ring substituted with methoxy and trimethylsilyl groups. This compound typically exhibits properties associated with both organic solvents and polar functional groups, making it soluble in various organic solvents while potentially showing limited solubility in water. The presence of the trimethylsilyl group enhances its stability and volatility, which can be advantageous in certain applications, such as in organic synthesis or as an intermediate in pharmaceutical development. Additionally, the methoxy group may influence its reactivity and interaction with biological systems. Overall, this compound's specific characteristics, including its molecular weight, melting point, and boiling point, would be determined through experimental analysis, contributing to its potential applications in medicinal chemistry and agrochemical formulations.
Formula:C14H24N2O3Si
InChI:InChI=1S/C14H24N2O3Si/c1-14(2,3)19-13(17)16-10-8-15-9-11(18-4)12(10)20(5,6)7/h8-9H,1-7H3,(H,16,17)
InChI key:InChIKey=FVEQUJHTDPTPMT-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C=1C(NC(OC(C)(C)C)=O)=CN=CC1OC
Synonyms:
  • Carbamic acid, N-[5-methoxy-4-(trimethylsilyl)-3-pyridinyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[5-methoxy-4-(trimethylsilyl)-3-pyridinyl]carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.