CAS 1045858-19-2

1,1-Dimethylethyl N-(4-cyano-5-methoxy-3-pyridinyl)carbamate

Description:

1,1-Dimethylethyl N-(4-cyano-5-methoxy-3-pyridinyl)carbamate, identified by its CAS number 1045858-19-2, is a chemical compound that features a carbamate functional group. This substance is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) attached to a nitrogen atom, which is further connected to a pyridine ring substituted with a cyano group and a methoxy group. The pyridine moiety contributes to the compound's potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The cyano group introduces a strong electron-withdrawing characteristic, which can influence the compound's reactivity and solubility. Additionally, the methoxy group can enhance lipophilicity, affecting the compound's interaction with biological membranes. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, although specific biological activities would require further investigation.

Formula: C₁₂H₁₅N₃O₃

InChI: InChI=1S/C12H15N3O3/c1-12(2,3)18-11(16)15-9-6-14-7-10(17-4)8(9)5-13/h6-7H,1-4H3,(H,15,16)

InChI key: InChIKey=BTDPKKLTFIYIHV-UHFFFAOYSA-N

SMILES: C(#N)C=1C(NC(OC(C)(C)C)=O)=CN=CC1OC

Synonyms:

• Carbamic acid, N-(4-cyano-5-methoxy-3-pyridinyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(4-cyano-5-methoxy-3-pyridinyl)carbamate