CAS 1045861-32-2
:B-[6-Amino-4-(trifluoromethyl)-3-pyridinyl]boronic acid
Description:
B-[6-Amino-4-(trifluoromethyl)-3-pyridinyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a pyridine ring substituted with an amino group and a trifluoromethyl group, which can influence its electronic properties and reactivity. The trifluoromethyl group is particularly notable for enhancing lipophilicity and altering the compound's biological activity. This substance may exhibit potential applications in drug development, particularly in the design of inhibitors for various biological targets. Additionally, the presence of the boronic acid moiety suggests utility in cross-coupling reactions, a key method in the synthesis of complex organic molecules. Overall, B-[6-Amino-4-(trifluoromethyl)-3-pyridinyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C6H6BF3N2O2
InChI:InChI=1S/C6H6BF3N2O2/c8-6(9,10)3-1-5(11)12-2-4(3)7(13)14/h1-2,13-14H,(H2,11,12)
InChI key:InChIKey=BFGHJUHRLUFXHE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(B(O)O)=CN=C(N)C1
Synonyms:- (6-Amino-4-(trifluoromethyl)pyridin-3-yl)boronic acid
- Boronic acid, B-[6-amino-4-(trifluoromethyl)-3-pyridinyl]-
- B-[6-Amino-4-(trifluoromethyl)-3-pyridinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
