CAS 104593-59-1
:2-(chloromethyl)-1-benzofuran
Description:
2-(Chloromethyl)-1-benzofuran is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of a chloromethyl group (-CH2Cl) at the 2-position of the benzofuran ring significantly influences its reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly as an intermediate in the production of pharmaceuticals and agrochemicals. The chloromethyl group can participate in nucleophilic substitution reactions, making it a versatile building block in chemical synthesis. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential medicinal applications. As with many chlorinated compounds, it is essential to handle 2-(chloromethyl)-1-benzofuran with care due to its potential toxicity and environmental impact. Proper safety measures should be observed when working with this substance in a laboratory setting.
Formula:C9H7ClO
InChI:InChI=1/C9H7ClO/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5H,6H2
Synonyms:- benzofuran, 2-(chloromethyl)-
- 2-(Chloromethyl)-1-benzofuran
- 2-chloromethylbenzofuran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.