CAS 104598-81-4

1,4-Dioxaspiro[4.5]decane, 7-methylene-

Description:

1,4-Dioxaspiro[4.5]decane, 7-methylene- is a chemical compound characterized by its unique spirocyclic structure, which features a dioxane ring fused to a decane framework. This compound contains two oxygen atoms within a five-membered dioxane ring, contributing to its distinctive chemical properties. The presence of a methylene group at the 7-position enhances its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit moderate polarity due to the oxygen atoms, which can influence solubility in various solvents. The spiro structure often leads to interesting conformational dynamics, affecting the compound's stability and reactivity. Additionally, 1,4-Dioxaspiro[4.5]decane derivatives may exhibit biological activity, making them of interest in medicinal chemistry. Overall, the unique structural features of this compound provide a foundation for exploring its chemical behavior and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₉H₁₄O₂

InChI: InChI=1/C9H14O2/c1-8-3-2-4-9(7-8)10-5-6-11-9/h1-7H2

Synonyms:

• 7-methylidene-1,4-dioxaspiro[4.5]decane
• 1,4-Dioxaspiro(4.5)decane, 7-methylene-

7-Methylidene-1,4-dioxaspiro[4.5]decane

CAS: 104598-81-4

Versatile small molecule scaffold

Formula: C₉H₁₄O₂

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-EEA59881