CAS 104599-36-2

3,5-dibromo-4-nitro-1H-pyrazole

Description:

3,5-Dibromo-4-nitro-1H-pyrazole is a heterocyclic organic compound characterized by the presence of a pyrazole ring, which is a five-membered ring containing two adjacent nitrogen atoms. The compound features two bromine substituents at the 3 and 5 positions and a nitro group at the 4 position, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of bromine atoms enhances its electrophilic character, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The nitro group can also participate in further chemical reactions, such as reduction or substitution. Additionally, the compound's properties, including solubility and stability, can vary based on the solvent and environmental conditions. Safety precautions should be taken when handling this compound, as halogenated and nitro compounds can pose health and environmental risks.

Formula: C₃HBr₂N₃O₂

InChI: InChI=1/C3HBr2N3O2/c4-2-1(8(9)10)3(5)7-6-2/h(H,6,7)

SMILES: c1(c(Br)[nH]nc1Br)N(=O)=O

Synonyms:

• 3,5-Dibromo-4-nitropyrazole

3,5-DIBROMO-4-NITRO-1H-PYRAZOLE

CAS: 104599-36-2

Formula: C₃HBr₂N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 270.8669

Ref: IN-DA003905

3,5-Dibromo-4-nitro-1H-pyrazole

CAS: 104599-36-2

3,5-Dibromo-4-nitro-1H-pyrazole

Purity: 98%

Molecular weight: 270.87g/mol

Ref: 54-OR95899

3,5-Dibromo-4-nitro-1H-pyrazole

CAS: 104599-36-2

Formula: C₃HBr₂N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 270.868

Ref: 10-F067388