CAS 104600-89-7

leucokinin I

Description:

Leucokinin I is a neuropeptide that belongs to the class of kinins, which are biologically active peptides involved in various physiological processes. It is primarily known for its role in the regulation of fluid balance and muscle contraction in certain invertebrates, particularly in crustaceans. The structure of leucokinin I typically features a sequence of amino acids that contribute to its biological activity, including effects on the contraction of smooth muscles and modulation of digestive processes. This peptide is synthesized in specific tissues and is released in response to various stimuli, influencing physiological responses such as feeding and movement. Leucokinin I may also play a role in the modulation of neuroendocrine functions. Its CAS number, 104600-89-7, is a unique identifier that facilitates the cataloging and study of this compound in scientific literature and databases. Overall, leucokinin I exemplifies the intricate interplay between neuropeptides and physiological regulation in living organisms.

Formula: C₄₁H₅₃N₁₁O₁₂

InChI: InChI=1/C41H53N11O12/c1-21(47-40(63)31-12-7-13-52(31)41(64)25(42)16-34(56)57)35(58)48-27(14-22-8-3-2-4-9-22)37(60)50-29(17-32(43)54)38(61)51-30(20-53)39(62)49-28(36(59)46-19-33(44)55)15-23-18-45-26-11-6-5-10-24(23)26/h2-6,8-11,18,21,25,27-31,45,53H,7,12-17,19-20,42H2,1H3,(H2,43,54)(H2,44,55)(H,46,59)(H,47,63)(H,48,58)(H,49,62)(H,50,60)(H,51,61)(H,56,57)/t21-,25-,27-,28-,29-,30-,31-/m0/s1

SMILES: C[C@@H](C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CO)C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=NCC(=N)O)O)O)O)O)O)N=C([C@@H]1CCCN1C(=O)[C@H](CC(=O)O)N)O

Synonyms:

• H-Asp-Pro-Ala-Phe-Asn-Ser-Trp-Gly-NH2
• L-alpha-aspartyl-L-prolyl-L-alanyl-L-phenylalanyl-L-asparaginyl-L-seryl-L-tryptophylglycinamide

Leucokinin I

CAS: 104600-89-7

Leucokinin I: eight-residue neuropeptide in bowfly's nervous system, sourced from Madeira cockroach head.

Formula: C₄₁H₅₃N₁₁O₁₂

Color and Shape: Solid

Molecular weight: 891.93

Ref: TM-T20688