CAS 1046079-40-6

1,3,4-Oxadiazol-2(3H)-one, 5-(aminomethyl)-, hydrochloride (1:1)

Description:

1,3,4-Oxadiazol-2(3H)-one, 5-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and three carbon atoms. This compound features an aminomethyl group, which contributes to its potential biological activity. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the oxadiazole moiety is often associated with diverse biological activities, including antimicrobial and anti-inflammatory properties. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. The compound's molecular interactions and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₃H₅N₃O₂·ClH

InChI: InChI=1S/C3H5N3O2.ClH/c4-1-2-5-6-3(7)8-2;/h1,4H2,(H,6,7);1H

InChI key: InChIKey=YXRVNWLUNSADLS-UHFFFAOYSA-N

SMILES: C(N)C=1OC(=O)NN1.Cl

Synonyms:

• 1,3,4-Oxadiazol-2(3H)-one, 5-(aminomethyl)-, hydrochloride (1:1)