CAS 104613-89-0
:1-(2-fluoroethyl)-2-methyl-5-nitroimidazole
Description:
1-(2-Fluoroethyl)-2-methyl-5-nitroimidazole is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a fluoroethyl group, which contributes to its potential reactivity and biological activity. The presence of a nitro group at the 5-position of the imidazole ring enhances its electron-withdrawing properties, which can influence its chemical behavior and interactions with biological systems. The methyl group at the 2-position adds to the compound's steric and electronic properties. This compound may exhibit antimicrobial or antiparasitic activities, making it of interest in pharmaceutical research. Its unique structure allows for various applications in medicinal chemistry, particularly in the development of drugs targeting specific pathogens. As with many nitro-containing compounds, it is essential to consider its stability, solubility, and potential toxicity in both laboratory and therapeutic contexts. Proper handling and safety measures should be observed due to the potential hazards associated with its chemical properties.
Formula:C6H8FN3O2
InChI:InChI=1/C6H8FN3O2/c1-5-8-4-6(10(11)12)9(5)3-2-7/h4H,2-3H2,1H3
SMILES:Cc1ncc(n1CCF)N(=O)=O
Synonyms:- Fluoro-norhydroxymetronidazole
- 1H-Imidazole, 1-(2-fluoro-18F-ethyl)-2-methyl-5-nitro-
- 1-(2-fluoroethyl)-2-methyl-5-nitro-1H-imidazole
- 1-(2-Fluoroethyl)-2-methyl-5-nitroimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.