CymitQuimica logo

CAS 104618-33-9

:

2-Amino-6-phthalimido-4,5,6,7-tetrahydro benzothiazole

Description:
2-Amino-6-phthalimido-4,5,6,7-tetrahydrobenzothiazole is a chemical compound characterized by its complex structure, which includes a benzothiazole core fused with a tetrahydro moiety and a phthalimido group. This compound typically exhibits properties associated with both amines and heterocycles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The benzothiazole framework contributes to its aromatic character, while the tetrahydro component may influence its physical properties, such as melting point and boiling point. The phthalimido substituent can enhance the compound's stability and may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the presence of nitrogen and sulfur atoms in its structure suggests potential applications in medicinal chemistry, particularly in the development of bioactive molecules. Overall, this compound's unique structural features and functional groups make it a subject of interest for further studies in various chemical and biological contexts.
Formula:C15H13N3O2S
InChI:InChI=1/C15H13N3O2S/c16-15-17-11-6-5-8(7-12(11)21-15)18-13(19)9-3-1-2-4-10(9)14(18)20/h1-4,8H,5-7H2,(H2,16,17)
SMILES:c1ccc2c(c1)C(=O)N(C1CCc3c(C1)sc(=N)[nH]3)C2=O
Synonyms:
  • 1H-isoindole-1,3(2H)-dione, 2-(2-amino-4,5,6,7-tetrahydro-6-benzothiazolyl)-
  • 2-(2-Amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.