
CAS 1046203-46-6
:5-(3-Piperidinyl)-1,3,4-oxadiazol-2(3H)-one
Description:
5-(3-Piperidinyl)-1,3,4-oxadiazol-2(3H)-one is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the piperidine moiety contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological properties. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic effects, although specific biological activities would depend on further empirical studies. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, making it a valuable scaffold in medicinal chemistry. Additionally, the compound's solubility, melting point, and reactivity would be influenced by the functional groups present and the overall molecular structure. As with many synthetic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of this substance would need to be assessed through appropriate studies.
Formula:C7H11N3O2
InChI:InChI=1S/C7H11N3O2/c11-7-10-9-6(12-7)5-2-1-3-8-4-5/h5,8H,1-4H2,(H,10,11)
InChI key:InChIKey=NTFXRFLZPDTOPZ-UHFFFAOYSA-N
SMILES:O=C1OC(=NN1)C2CCCNC2
Synonyms:- 5-(3-Piperidinyl)-1,3,4-oxadiazol-2(3H)-one
- 1,3,4-Oxadiazol-2(3H)-one, 5-(3-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.