CAS 104625-48-1
:Activins
Description:
Activins are a group of proteins that belong to the transforming growth factor-beta (TGF-β) superfamily, playing crucial roles in various biological processes, including cell growth, differentiation, and apoptosis. The substance with the CAS number 104625-48-1 specifically refers to Activin A, which is a dimeric protein composed of two inhibin βA subunits. Activin A is primarily involved in regulating reproductive functions, including follicle-stimulating hormone (FSH) secretion, and has been implicated in various physiological processes such as inflammation, wound healing, and tissue repair. It exerts its effects by binding to specific receptors on target cells, initiating intracellular signaling pathways that influence gene expression. Activins are also studied for their potential therapeutic applications in conditions like infertility, cancer, and fibrotic diseases. In terms of physical properties, Activins are typically found in a soluble form and are sensitive to environmental conditions such as pH and temperature, which can affect their stability and biological activity.
Formula:C42H50Cl3N3O5
InChI:InChI=1/C27H34O3.C15H16Cl3N3O2/c1-27-16-15-22-21-11-9-20(28)17-19(21)8-10-23(22)24(27)12-13-25(27)30-26(29)14-7-18-5-3-2-4-6-18;1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18/h2-6,17,21-25H,7-16H2,1H3;3,5,8-10H,2,4,6-7H2,1H3/t21-,22+,23+,24-,25-,27-;/m0./s1
Synonyms:- Activin A
- Fsh-releasing protein
- Amniotic mesoderm-inducing factor
- (17beta)-3-oxoestr-4-en-17-yl 3-phenylpropanoate
- EYDF
- Xenopus tissue culture mesoderm-inducing factor
- Megakaryocyte differentiation activity
- Homo-activin A
- Erythroid differentiation factor
- Activin
- Bovine activin A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Activin A human
CAS:Controlled ProductActivin A human is a dimeric protein, which is a member of the transforming growth factor-beta (TGF-β) superfamily. It is derived from human sources, primarily through recombinant DNA technology that allows for its precise expression and purification. Activin A plays crucial roles in a wide range of biological processes by binding to its receptors, leading to the activation of intracellular signaling pathways such as SMAD2/3 activation.The primary mode of action of Activin A involves modulating cellular growth, differentiation, and apoptosis. It exerts its effects by influencing gene expression, thereby impacting processes such as embryogenesis, inflammation, and repair mechanisms. Its influence on the regulation of erythropoiesis and iron metabolism is also significant.In scientific research, Activin A human is extensively utilized to study its role in various physiological and pathological conditions. It is instrumental in vitro to explore mechanisms underpinning cancer, reproductive biology, and immune responses. Furthermore, scientists investigate its therapeutic potential in regenerative medicine and its involvement in fibrotic diseases. The diverse functions and applications of Activin A underscore its importance as a critical factor in cellular and molecular biology research.Formula:C27H34O3Purity:Min. 95%Molecular weight:406.6 g/mol
